Difference between revisions of "RXN-14283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...")
(Created page with "Category:Gene == Gene Tiso_gene_12431 == * Synonym(s): == Reactions associated == * RXN-14480 ** pantograph-esiliculosus * RXN-14481 ** pantograph-e...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] ==
+
== Gene Tiso_gene_12431 ==
* smiles:
+
** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
+
* inchi key:
+
** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
+
* common name:
+
** 5-hydroxyindole thiazolidine carboxylate
+
* molecular weight:
+
** 278.325   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxyindole thiazolidine carboxylic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-14480]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
* [[RXN-10779]]
+
* [[RXN-14481]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN0-5063]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-14480|RXN-14481|RXN0-5063}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.169392.html 169392]
+
{{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}}
+
{{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}}
+
{{#set: common name=5-hydroxyindole thiazolidine carboxylate}}
+
{{#set: molecular weight=278.325    }}
+
{{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}}
+
{{#set: consumed or produced by=RXN-10779}}
+

Revision as of 18:56, 18 March 2018

Gene Tiso_gene_12431

  • Synonym(s):

Reactions associated

Pathways associated

External links