Difference between revisions of "Tiso gene 19650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC1(=C(O)C=CC(C(O)C=O)=C1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N |
* common name: | * common name: | ||
− | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 182.176 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** MOPEGAL |
− | ** | + | ** 4-hydroxy-3-methoxymandelaldehyde |
+ | ** 3-methoxy 4-hydroxy mandelic aldehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-10915]] |
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.389601.html 389601] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583] |
− | {{#set: common name= | + | * HMDB : HMDB04061 |
− | {{#set: | + | {{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}} |
+ | {{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}} | ||
+ | {{#set: molecular weight=182.176 }} | ||
+ | {{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}} | ||
+ | {{#set: reversible reaction associated=RXN-10915}} |
Revision as of 17:56, 18 March 2018
Contents
Metabolite CPD-11876
- smiles:
- COC1(=C(O)C=CC(C(O)C=O)=C1)
- inchi key:
- InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
- common name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- molecular weight:
- 182.176
- Synonym(s):
- MOPEGAL
- 4-hydroxy-3-methoxymandelaldehyde
- 3-methoxy 4-hydroxy mandelic aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links