Difference between revisions of "LYSINE--TRNA-LIGASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=...")
(Created page with "Category:Gene == Gene Tiso_gene_19542 == * left end position: ** 26 * transcription direction: ** POSITIVE * right end position: ** 2036 * centisome position: ** 1.1596788...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+
== Gene Tiso_gene_19542 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** 26
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide
+
** 2036
−
* molecular weight:
+
* centisome position:
−
** 826.095    
+
** 1.1596788    
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyronine glucuronide
 
−
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-
 
−
** T3G
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[GPPSYN-RXN]]
−
* [[RXN-10607]]
+
** [[pantograph]]-[[esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* [[R06284]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[RXN-7663]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-7673]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-7674]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN1F-66]]
 +
** in-silico_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7736]]
 +
* [[PWY-7764]]
 +
* [[PWY-6859]]
 +
* [[PWY-7709]]
 +
* [[PWY-7102]]
 +
* [[PWY-7182]]
 +
* [[PWY-7659]]
 +
* [[PWY-5123]]
 +
* [[PWY-5122]]
 +
* [[PWY-5064]]
 +
* [[PWY-6383]]
 +
* [[PWY-7141]]
 +
* [[PWY-5068]]
 +
* [[PWY-7410]]
 +
* [[PWY-5086]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=26}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659063 90659063]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: right end position=2036}}
−
{{#set: inchi key=InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M}}
+
{{#set: centisome position=1.1596788    }}
−
{{#set: common name=3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide}}
+
{{#set: reaction associated=GPPSYN-RXN|R06284|RXN-7663|RXN-7673|RXN-7674|RXN1F-66}}
−
{{#set: molecular weight=826.095    }}
+
{{#set: pathway associated=PWY-7736|PWY-7764|PWY-6859|PWY-7709|PWY-7102|PWY-7182|PWY-7659|PWY-5123|PWY-5122|PWY-5064|PWY-6383|PWY-7141|PWY-5068|PWY-7410|PWY-5086}}
−
{{#set: common name=triiodothyronine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-|T3G}}
+
−
{{#set: produced by=RXN-10607}}
+

Revision as of 17:57, 18 March 2018

Gene Tiso_gene_19542

  • left end position:
    • 26
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2036
  • centisome position:
    • 1.1596788
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LYSINE--TRNA-LIGASE-RXN&oldid=20824"