|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Reaction]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINE S-ADENOSYLMETHIONINE] == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME255 RME255] == |
| − | * smiles: | + | * direction: |
| − | ** C[S+](CC3(C(O)C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))CCC(C([O-])=O)[N+] | + | ** LEFT-TO-RIGHT |
| − | * inchi key:
| + | |
| − | ** InChIKey=MEFKEPWMEQBLKI-AIRLBKTGSA-O
| + | |
| | * common name: | | * common name: |
| − | ** S-adenosyl-L-methionine | + | ** RME255 |
| − | * molecular weight:
| + | |
| − | ** 399.444
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** AdoMet
| |
| − | ** SAM
| |
| − | ** 2-S-adenosyl-L-methionine
| |
| − | ** S-adenosyl-methionine
| |
| − | ** adenosylmethionine
| |
| − | ** S-adenosylmethionine
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reaction Formula == |
| − | * [[RXN0-5063]] | + | * With identifiers: |
| − | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] | + | ** 0.32 [[DCTP]][c] '''+''' 1.372 [[ATP]][c] '''+''' 2.372 [[WATER]][c] '''+''' 0.18 [[TTP]][c] '''+''' 0.32 [[DGTP]][c] '''+''' 0.18 [[DATP]][c] '''=>''' 1.372 [[Pi]][c] '''+''' 1.372 [[ADP]][c] '''+''' 1.0 [[DNA-Holder]][c] '''+''' 1.0 [[PPI]][c] '''+''' 2.372 [[PROTON]][c] |
| − | * [[RXN-14177]] | + | * With common name(s): |
| − | * [[RXN-14950]]
| + | ** 0.32 dCTP[c] '''+''' 1.372 ATP[c] '''+''' 2.372 H2O[c] '''+''' 0.18 dTTP[c] '''+''' 0.32 dGTP[c] '''+''' 0.18 dATP[c] '''=>''' 1.372 phosphate[c] '''+''' 1.372 ADP[c] '''+''' 1.0 DNA[c] '''+''' 1.0 diphosphate[c] '''+''' 2.372 H+[c] |
| − | * [[RXN0-949]]
| + | |
| − | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
| + | == Genes associated with this reaction == |
| − | * [[2.1.1.137-RXN]]
| + | == Pathways == |
| − | * [[RXN-8340]]
| + | == Reconstruction information == |
| − | * [[RXN-1104]]
| + | * Category: [[manual]] |
| − | * [[RXN-2762]]
| + | ** Source: [[manual-primary_network]] |
| − | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
| + | |
| − | * [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-14480]]
| + | |
| − | * [[RXN-1143]]
| + | |
| − | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[2.8.1.6-RXN]]
| + | |
| − | * [[2.1.1.109-RXN]]
| + | |
| − | * [[UROPORIIIMETHYLTRANSA-RXN]]
| + | |
| − | * [[RXN-10847]]
| + | |
| − | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
| + | |
| − | * [[RXN-12375]]
| + | |
| − | * [[DHHB-METHYLTRANSFER-RXN]]
| + | |
| − | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-14957]]
| + | |
| − | * [[RXN-14959]]
| + | |
| − | * [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-11046]]
| + | |
| − | * [[RXN1G-2544]]
| + | |
| − | * [[RXN-2542]]
| + | |
| − | * [[RXN-11374]]
| + | |
| − | * [[HEMN-RXN]]
| + | |
| − | * [[RXN-11373]]
| + | |
| − | * [[RXN-11370]]
| + | |
| − | * [[RXN-13403]]
| + | |
| − | * [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-9500]]
| + | |
| − | * [[RXN-13406]]
| + | |
| − | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN1G-3641]]
| + | |
| − | * [[RXN-3422]]
| + | |
| − | * [[RXN-12377]]
| + | |
| − | * [[2.1.1.138-RXN]]
| + | |
| − | * [[2.1.1.113-RXN]]
| + | |
| − | * [[SAMDECARB-RXN]]
| + | |
| − | * [[RXN-12376]]
| + | |
| − | * [[2.1.1.143-RXN]]
| + | |
| − | * [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-7605]]
| + | |
| − | * [[RXN-17473]]
| + | |
| − | * [[RXN-17472]]
| + | |
| − | * [[RXN-13935]]
| + | |
| − | * [[RXN0-5144]]
| + | |
| − | * [[RXN-14326]]
| + | |
| − | * [[RXN0-1342]]
| + | |
| − | * [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[RXN-8675]]
| + | |
| − | * [[RXN-2562]]
| + | |
| − | * [[RXN0-6515]]
| + | |
| − | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
| + | |
| − | * [[2.1.1.127-RXN]]
| + | |
| − | * [[RXN0-5419]]
| + | |
| − | * [[RXN-4021]]
| + | |
| − | * [[R06859]] | + | |
| − | * [[RXN-12347]] | + | |
| − | * [[RXN-12459]] | + | |
| − | * [[RXN-9235]]
| + | |
| − | * [[RXN-11856]]
| + | |
| − | * [[RXN-12348]]
| + | |
| − | * [[2.1.1.77-RXN]]
| + | |
| − | * [[2.1.1.79-RXN]]
| + | |
| − | * [[RXN-11637]]
| + | |
| − | * [[RXN-14481]]
| + | |
| − | * [[AMCL]]
| + | |
| − | * [[RXN-11633]]
| + | |
| − | * [[4.4.1.14-RXN]]
| + | |
| − | * [[RXN-11201]]
| + | |
| − | * [[RXN-11574]]
| + | |
| − | * [[RXN-11598]]
| + | |
| − | * [[RXN-13588]]
| + | |
| − | * [[RXN-14917]]
| + | |
| − | * [[RXN-11638]]
| + | |
| − | == Reaction(s) known to produce the compound == | + | |
| − | * [[S-ADENMETSYN-RXN]]
| + | |
| − | == Reaction(s) of unknown directionality == | + | |
| − | * [[AMETt2h]] | + | |
| − | * [[DAPASYN-RXN]] | + | |
| − | * [[AMETt2m]]
| + | |
| | == External links == | | == External links == |
| − | * CAS : 29908-03-0
| + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | * METABOLIGHTS : MTBLC59789
| + | {{#set: common name=RME255}} |
| − | * PUBCHEM:
| + | {{#set: in pathway=}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24762165 24762165]
| + | {{#set: reconstruction category=manual}} |
| − | * HMDB : HMDB01185
| + | {{#set: reconstruction source=manual-primary_network}} |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C00019 C00019]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59789 59789]
| + | |
| − | * BIGG : amet
| + | |
| − | {{#set: smiles=C[S+](CC3(C(O)C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))CCC(C([O-])=O)[N+]}} | + | |
| − | {{#set: inchi key=InChIKey=MEFKEPWMEQBLKI-AIRLBKTGSA-O}}
| + | |
| − | {{#set: common name=S-adenosyl-L-methionine}} | + | |
| − | {{#set: molecular weight=399.444 }} | + | |
| − | {{#set: common name=AdoMet|SAM|2-S-adenosyl-L-methionine|S-adenosyl-methionine|adenosylmethionine|S-adenosylmethionine}} | + | |
| − | {{#set: consumed by=RXN0-5063|RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN|RXN-14177|RXN-14950|RXN0-949|NICOTINAMIDE-N-METHYLTRANSFERASE-RXN|2.1.1.137-RXN|RXN-8340|RXN-1104|RXN-2762|2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN|HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN|RXN-14480|RXN-1143|QUERCETIN-3-O-METHYLTRANSFERASE-RXN|2.8.1.6-RXN|2.1.1.109-RXN|UROPORIIIMETHYLTRANSA-RXN|RXN-10847|2-OCTAPRENYL-6-OHPHENOL-METHY-RXN|RXN-12375|DHHB-METHYLTRANSFER-RXN|HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-14957|RXN-14959|TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN|RXN-11046|RXN1G-2544|RXN-2542|RXN-11374|HEMN-RXN|RXN-11373|RXN-11370|RXN-13403|MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN|RXN-9500|RXN-13406|TOCOPHEROL-O-METHYLTRANSFERASE-RXN|RXN1G-3641|RXN-3422|RXN-12377|2.1.1.138-RXN|2.1.1.113-RXN|SAMDECARB-RXN|RXN-12376|2.1.1.143-RXN|TRNA-URACIL-5--METHYLTRANSFERASE-RXN|RXN-7605|RXN-17473|RXN-17472|RXN-13935|RXN0-5144|RXN-14326|RXN0-1342|DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN|RXN-8675|RXN-2562|RXN0-6515|CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN|2.1.1.127-RXN|RXN0-5419|RXN-4021|R06859|RXN-12347|RXN-12459|RXN-9235|RXN-11856|RXN-12348|2.1.1.77-RXN|2.1.1.79-RXN|RXN-11637|RXN-14481|AMCL|RXN-11633|4.4.1.14-RXN|RXN-11201|RXN-11574|RXN-11598|RXN-13588|RXN-14917|RXN-11638}}
| + | |
| − | {{#set: produced by=S-ADENMETSYN-RXN}}
| + | |
| − | {{#set: consumed or produced by=AMETt2h|DAPASYN-RXN|AMETt2m}} | + | |
