Difference between revisions of "Tiso gene 3579"

Revision as of 18:59, 18 March 2018

"CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-containing-diamino-hydro-formamidops DNA-containing-diamino-hydro-formamidops] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
+* smiles:
+** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
+* inchi key:
+** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
 * common name:
-** a ring-opened 7-methylguanine in DNA
+** 26,27-dehydrozymosterol
+* molecular weight:
+** 382.628
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
-* [[3.2.2.23-RXN]]
+* [[RXN-11201]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a ring-opened 7-methylguanine in DNA}}
+* PUBCHEM:
-{{#set: consumed by=3.2.2.23-RXN}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
+{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
+{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
+{{#set: common name=26,27-dehydrozymosterol}}
+{{#set: molecular weight=382.628    }}
+{{#set: consumed by=RXN-11201}}