Difference between revisions of "PWY-7315"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
(Created page with "Category:Gene == Gene Tiso_gene_4902 == * left end position: ** 11649 * transcription direction: ** POSITIVE * right end position: ** 14018 * centisome position: ** 82.029...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_4902 == |
| − | * | + | * left end position: |
| − | ** | + | ** 11649 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 14018 |
| − | * | + | * centisome position: |
| − | ** | + | ** 82.029434 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[PROTEIN-KINASE-RXN]] | |
| − | * [[RXN- | + | ** experimental_annotation |
| − | == | + | ***automated-name-match |
| + | * [[RXN-8443]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-5381]] | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=11649}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: right end position=14018}} |
| − | {{#set: | + | {{#set: centisome position=82.029434 }} |
| − | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-5381}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 19:01, 18 March 2018
Gene Tiso_gene_4902
- left end position:
- 11649
- transcription direction:
- POSITIVE
- right end position:
- 14018
- centisome position:
- 82.029434
- Synonym(s):
Reactions associated
- PROTEIN-KINASE-RXN
- experimental_annotation
- automated-name-match
- experimental_annotation
- RXN-8443
