Difference between revisions of "Tiso gene 15682"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9519 == * Synonym(s): == Reactions associated == * ARYLSULFAT-RXN ** pantograph-esiliculosus == Pathways associated == == Exte...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == |
+ | * smiles: | ||
+ | ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** 4-methyl-3-oxoadipate | ||
+ | * molecular weight: | ||
+ | ** 172.137 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-methyl-3-ketoadipate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10083]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441] | ||
+ | {{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=4-methyl-3-oxoadipate}} | ||
+ | {{#set: molecular weight=172.137 }} | ||
+ | {{#set: common name=4-methyl-3-ketoadipate}} | ||
+ | {{#set: produced by=RXN-10083}} |
Revision as of 19:01, 18 March 2018
Contents
Metabolite CPD-10826
- smiles:
- CC(C(=O)CC(=O)[O-])CC(=O)[O-]
- inchi key:
- InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
- common name:
- 4-methyl-3-oxoadipate
- molecular weight:
- 172.137
- Synonym(s):
- 4-methyl-3-ketoadipate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C(=O)CC(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.