Difference between revisions of "16S-rRNA-cytidine1402"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_299 == * left end position: ** 35269 * transcription direction: ** POSITIVE * right end position: ** 36163 * centisome position: ** 97.1410...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-634 CPD-634] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N |
| − | * | + | * common name: |
| − | ** | + | ** castasterone |
| − | * | + | * molecular weight: |
| − | ** | + | ** 464.684 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-779]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=133534 133534] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23051 23051] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15794 C15794] | ||
| + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N}} | ||
| + | {{#set: common name=castasterone}} | ||
| + | {{#set: molecular weight=464.684 }} | ||
| + | {{#set: produced by=RXN-779}} | ||
Revision as of 18:02, 18 March 2018
Contents
Metabolite CPD-634
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=VYUIKSFYFRVQLF-YLNAYWRASA-N
- common name:
- castasterone
- molecular weight:
- 464.684
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
