Difference between revisions of "Tiso gene 13087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AASP AASP] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:adenylylsulfate 3'-phosphotransfe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AASP AASP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
 +
* inchi key:
 +
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** ATP:adenylylsulfate 3'-phosphotransferase
+
** bisorganyltrisulfane
 +
* molecular weight:
 +
** 644.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** GS3G
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[APS]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PAPS]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-10851]]
−
** 1.0 adenosine 5'-phosphosulfate[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 3'-phosphoadenylyl-sulfate[c] '''+''' 1.0 H+[c] '''+''' 1.0 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17878]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:adenylylsulfate 3'-phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
−
{{#set: gene associated=Tiso_gene_17878}}
+
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=bisorganyltrisulfane}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=644.686    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=GS3G}}
 +
{{#set: reversible reaction associated=RXN-10851}}

Revision as of 18:03, 18 March 2018

Metabolite CPD-11763

  • smiles:
    • C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
  • inchi key:
    • InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
  • common name:
    • bisorganyltrisulfane
  • molecular weight:
    • 644.686
  • Synonym(s):
    • GS3G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13087&oldid=21535"