Difference between revisions of "RXN-4821"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...")
(Created page with "Category:Gene == Gene Tiso_gene_15820 == * left end position: ** 1467 * transcription direction: ** POSITIVE * right end position: ** 4417 * centisome position: ** 30.6903...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] ==
+
== Gene Tiso_gene_15820 ==
−
* smiles:
+
* left end position:
−
** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
+
** 1467
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** violaxanthin
+
** 4417
−
* molecular weight:
+
* centisome position:
−
** 600.88    
+
** 30.690378    
 
* Synonym(s):
 
* Synonym(s):
−
** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7984]]
+
* [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-7979]]
+
***ec-number
−
* [[RXN-13193]]
+
* [[RXN-14240]]
−
* [[ANXANor]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[RXN-13185]]
+
* [[RXN-15288]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17352]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-8635]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1467}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4417}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288]
+
{{#set: centisome position=30.690378   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614]
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
* HMDB : HMDB03101
+
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
+
−
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}}
+
−
{{#set: common name=violaxanthin}}
+
−
{{#set: molecular weight=600.88   }}
+
−
{{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}}
+
−
{{#set: consumed by=RXN-7984}}
+
−
{{#set: produced by=RXN-7979|RXN-13193|ANXANor}}
+
−
{{#set: consumed or produced by=RXN-13185}}
+

Revision as of 18:04, 18 March 2018

Gene Tiso_gene_15820

  • left end position:
    • 1467
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4417
  • centisome position:
    • 30.690378
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-4821&oldid=21728"