Difference between revisions of "BUTANOL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ABor ABor] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-Aminobutyraldehyde:NAD+ oxidoreduct...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 3-isopropyl-8-(methylthio)-2-oxooctanoate |
+ | * molecular weight: | ||
+ | ** 246.278 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-18205]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-18204]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L}} |
− | {{#set: | + | {{#set: common name=3-isopropyl-8-(methylthio)-2-oxooctanoate}} |
− | {{#set: | + | {{#set: molecular weight=246.278 }} |
− | {{#set: | + | {{#set: consumed by=RXN-18205}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-18204}} |
− | + |
Revision as of 19:05, 18 March 2018
Contents
Metabolite CPD-19489
- smiles:
- CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
- common name:
- 3-isopropyl-8-(methylthio)-2-oxooctanoate
- molecular weight:
- 246.278
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.