Difference between revisions of "1.14.11.18-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-35...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-3568]
−
* inchi key:
+
−
** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 3-acetylamino-4-hydroxybenzaldehyde
+
** stellariose and mediose biosynthesis
−
* molecular weight:
+
−
** 178.167   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** galactosyl-oligosaccharides biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.123-RXN]]
−
* [[RXN-13871]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_18913]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.82-RXN 2.4.1.82-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11490 RXN-11490]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11491 RXN-11491]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11492 RXN-11492]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3568}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664]
+
{{#set: common name=stellariose and mediose biosynthesis}}
−
{{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}}
+
{{#set: common name=galactosyl-oligosaccharides biosynthesis}}
−
{{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}}
+
{{#set: reaction found=1}}
−
{{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}}
+
{{#set: total reaction=5}}
−
{{#set: molecular weight=178.167    }}
+
{{#set: completion rate=20.0}}
−
{{#set: consumed or produced by=RXN-13871}}
+

Revision as of 18:05, 18 March 2018

Pathway PWY-6525

  • taxonomic range:
  • common name:
    • stellariose and mediose biosynthesis
  • Synonym(s):
    • galactosyl-oligosaccharides biosynthesis

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.14.11.18-RXN&oldid=21852"