Difference between revisions of "PWY-5047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
−
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
 
* common name:
 
* common name:
−
** ppGpp
+
** thyroid hormone metabolism II (via conjugation and/or degradation)
−
* molecular weight:
+
−
** 598.123   
+
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine tetraphosphate
 
−
** guanosine 5'-diphosphate,3'-diphosphate
 
−
** guanosine 3',5'-bispyrophosphate
 
−
** guanosine 3',5'-bis(diphosphate)
 
−
** guanosine 3'-diphosphate 5'-diphosphate
 
−
** magic spot
 
−
** guanosine-5',3'-tetraphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PPGPPSYN-RXN]]
+
'''11''' reactions found over '''15''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-10606]]
−
* [[GDPPYPHOSKIN-RXN]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_14141]]
−
* [[GBDP]]
+
*** [[Tiso_gene_14140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10607]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14141]]
 +
*** [[Tiso_gene_14140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10608]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10609]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10614]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5505]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10615]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5505]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-10616]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10617]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10618]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14141]]
 +
*** [[Tiso_gene_14140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-10619]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14140]]
 +
*** [[Tiso_gene_14141]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[THYROXINE-DEIODINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20481]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10610 RXN-10610]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10611 RXN-10611]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10612 RXN-10612]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10613 RXN-10613]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04022
+
{{#set: taxonomic range=TAX-7742}}
−
* PUBCHEM:
+
{{#set: common name=thyroid hormone metabolism II (via conjugation and/or degradation)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
{{#set: reaction found=11}}
−
* HMDB : HMDB59638
+
{{#set: total reaction=15}}
−
* LIGAND-CPD:
+
{{#set: completion rate=73.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
−
* BIGG : ppgpp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
−
{{#set: common name=ppGpp}}
+
−
{{#set: molecular weight=598.123    }}
+
−
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
−
{{#set: consumed by=PPGPPSYN-RXN}}
+
−
{{#set: produced by=GDPPYPHOSKIN-RXN}}
+
−
{{#set: consumed or produced by=GBDP}}
+

Revision as of 18:06, 18 March 2018

Pathway PWY-6261

  • taxonomic range:
  • common name:
    • thyroid hormone metabolism II (via conjugation and/or degradation)
  • Synonym(s):

Reaction(s) found

11 reactions found over 15 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5047&oldid=21928"