Difference between revisions of "RXN-7978"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * smiles: ** CC(C)(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=JTEYKUFKXGD...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)(O)C(O)C(=O)[O-]
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
 
* common name:
 
* common name:
** phosphatidylglycerol biosynthesis I (plastidic)
+
** (2R)-2,3-dihydroxy-3-methylbutanoate
 +
* molecular weight:
 +
** 133.124   
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2,3-dihydroxy-3-methylbutanoate
 +
** (R)-2,3-dihydroxy-isovalerate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''4''' reactions in the full pathway
+
* [[DMHL]]
* [[PGPPHOSPHA-RXN]]
+
* [[DHAD_3mob_h]]
* [[PHOSPHAGLYPSYN-RXN]]
+
* [[DHAD_3mob]]
* [[PWY0-1319]]
+
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
== Reaction(s) not found ==
+
== Reaction(s) known to produce the compound ==
 +
== Reaction(s) of unknown directionality ==
 +
* [[ACETOLACTREDUCTOISOM-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* LIGAND-CPD:
{{#set: taxonomic range=TAX-2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272]
{{#set: common name=phosphatidylglycerol biosynthesis I (plastidic)}}
+
* CHEMSPIDER:
{{#set: reaction found=3}}
+
** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355]
{{#set: reaction not found=4}}
+
* CHEBI:
{{#set: completion rate=75.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351]
 +
* HMDB : HMDB12141
 +
{{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}}
 +
{{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}}
 +
{{#set: molecular weight=133.124    }}
 +
{{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}}
 +
{{#set: consumed by=DMHL|DHAD_3mob_h|DHAD_3mob|DIHYDROXYISOVALDEHYDRAT-RXN}}
 +
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN}}

Revision as of 19:07, 18 March 2018

Metabolite CPD-13357

  • smiles:
    • CC(C)(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
  • common name:
    • (2R)-2,3-dihydroxy-3-methylbutanoate
  • molecular weight:
    • 133.124
  • Synonym(s):
    • (R)-2,3-dihydroxy-3-methylbutanoate
    • (R)-2,3-dihydroxy-isovalerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.