Difference between revisions of "TRNAs-with-queuine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4668 TAX-46...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4668 TAX-4668] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Amaryllidacea alkaloids biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''2''' reactions found over '''25''' reactions in the full pathway |
− | * [[RXN- | + | * [[RXN-8872]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_1035]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[TYROSINE-DECARBOXYLASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3686]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18120 RXN-18120] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18121 RXN-18121] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18122 RXN-18122] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18123 RXN-18123] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18124 RXN-18124] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18125 RXN-18125] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18126 RXN-18126] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18127 RXN-18127] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18128 RXN-18128] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18129 RXN-18129] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18132 RXN-18132] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18133 RXN-18133] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18134 RXN-18134] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18135 RXN-18135] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18136 RXN-18136] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18137 RXN-18137] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18138 RXN-18138] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18140 RXN-18140] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18141 RXN-18141] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18142 RXN-18142] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18152 RXN-18152] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-18153 RXN-18153] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8871 RXN-8871] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4668}} | |
− | + | {{#set: common name=Amaryllidacea alkaloids biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=25}} | |
− | + | {{#set: completion rate=8.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:07, 18 March 2018
Pathway PWY-7826
- taxonomic range:
- common name:
- Amaryllidacea alkaloids biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 25 reactions in the full pathway
- RXN-8872
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- TYROSINE-DECARBOXYLASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-18120
- RXN-18121
- RXN-18122
- RXN-18123
- RXN-18124
- RXN-18125
- RXN-18126
- RXN-18127
- RXN-18128
- RXN-18129
- RXN-18132
- RXN-18133
- RXN-18134
- RXN-18135
- RXN-18136
- RXN-18137
- RXN-18138
- RXN-18140
- RXN-18141
- RXN-18142
- RXN-18152
- RXN-18153
- RXN-8871