Difference between revisions of "PWY-6352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5874 PWY-5874] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
 +
* inchi key:
 +
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
 
* common name:
 
* common name:
** heme degradation
+
** cyanidin
 +
* molecular weight:
 +
** 285.232   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 +
** 3,3',4',5,7-pentahydroxyflavylium
 +
** cyanidol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-9725]]
* [[BILIVERDIN-REDUCTASE-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[RXN-602]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: common name=heme degradation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
{{#set: reaction found=2}}
+
* CHEBI:
{{#set: reaction not found=2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
{{#set: completion rate=100.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
 +
* HMDB : HMDB02708
 +
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
 +
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
 +
{{#set: common name=cyanidin}}
 +
{{#set: molecular weight=285.232    }}
 +
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
 +
{{#set: consumed by=RXN-9725}}
 +
{{#set: produced by=RXN-602}}

Revision as of 18:08, 18 March 2018

Metabolite CPD-591

  • smiles:
    • C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
  • inchi key:
    • InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
  • common name:
    • cyanidin
  • molecular weight:
    • 285.232
  • Synonym(s):
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
    • 3,3',4',5,7-pentahydroxyflavylium
    • cyanidol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)" cannot be used as a page name in this wiki.