Difference between revisions of "RXN-14271"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] == * direction: ** LEFT-TO-RIGHT * common name: ** (S)-3-hydroxypalmitoyl-CoA...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14271 RXN-14271] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C(C1(CCC2(C(C1)O2)(C)))C
 +
* inchi key:
 +
** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
 
* common name:
 
* common name:
−
** (S)-3-hydroxypalmitoyl-CoA oxidoreductase
+
** (+)-(1S,4R)-limonene-1,2- epoxide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.211 EC-1.1.1.211]
+
** 152.236   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD]][c] '''+''' 1 [[CPD0-2232]][c] '''=>''' 1 [[3-OXOPALMITOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-9464]]
−
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxyhexadecanoyl-CoA[c] '''=>''' 1 3-oxo-palmitoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5857]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_14262]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
+
−
** '''6''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
+
−
** '''6''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31160 31160]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524]
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04737 R04737]
+
** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB35158
−
{{#set: common name=(S)-3-hydroxypalmitoyl-CoA oxidoreductase}}
+
{{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}}
−
{{#set: ec number=EC-1.1.1.211}}
+
{{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}}
−
{{#set: gene associated=Tiso_gene_5857|Tiso_gene_14262}}
+
{{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}}
−
{{#set: in pathway=PWY-7654|PWY-7656}}
+
{{#set: molecular weight=152.236    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: reversible reaction associated=RXN-9464}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii|esiliculosus|athaliana}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Revision as of 19:09, 18 March 2018

Metabolite CPD-10139

  • smiles:
    • C=C(C1(CCC2(C(C1)O2)(C)))C
  • inchi key:
    • InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
  • common name:
    • (+)-(1S,4R)-limonene-1,2- epoxide
  • molecular weight:
    • 152.236
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14271&oldid=22309"