Difference between revisions of "Aliphatic-Amines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-L-CITRULLINE PROTEIN-L-CITRULLINE] == * common name: ** a [protein]-L-citrulline * Syno...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-L-CITRULLINE PROTEIN-L-CITRULLINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
 +
* smiles:
 +
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
 +
* inchi key:
 +
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
 
* common name:
 
* common name:
** a [protein]-L-citrulline
+
** hydroxybupropion
 +
* molecular weight:
 +
** 256.752   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
+
* [[RXN66-181]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [protein]-L-citrulline}}
+
* PUBCHEM:
{{#set: produced by=PROTEIN-ARGININE-DEIMINASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
 +
* HMDB : HMDB12235
 +
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
 +
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
 +
{{#set: common name=hydroxybupropion}}
 +
{{#set: molecular weight=256.752    }}
 +
{{#set: produced by=RXN66-181}}

Revision as of 19:09, 18 March 2018

Metabolite CPD-3483

  • smiles:
    • CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
  • inchi key:
    • InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
  • common name:
    • hydroxybupropion
  • molecular weight:
    • 256.752
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.