Difference between revisions of "RXN1G-396"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-fructofuranose-1-phosphate D-fructofuranose-1-phosphate] == * common name: ** D-fructofuranos...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-fructofuranose-1-phosphate D-fructofuranose-1-phosphate] ==
* smiles:
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
 
* common name:
 
* common name:
** (2E,7Z)-hexadecenoyl-CoA
+
** D-fructofuranose 1-phosphate
* molecular weight:
+
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 16:2-Δ2,Δ7-CoA
 
** 2-trans,7-cis-hexadecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17779]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[FPGPL]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=D-fructofuranose 1-phosphate}}
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
{{#set: reversible reaction associated=FPGPL}}
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=997.883    }}
+
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
{{#set: produced by=RXN-17779}}
+

Revision as of 19:11, 18 March 2018

Metabolite D-fructofuranose-1-phosphate

  • common name:
    • D-fructofuranose 1-phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links