Difference between revisions of "PWY-6949"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-39 CPD66-39] == * common name: ** a 2,3,4-saturated fatty acid * Synonym(s): == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-39 CPD66-39] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3 | + | ** a 2,3,4-saturated fatty acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[TRANS-RXN0-623]] | ||
| + | * [[ACYLCOASYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[THIOESTER-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 2,3,4-saturated fatty acid}} | |
| − | + | {{#set: consumed by=TRANS-RXN0-623|ACYLCOASYN-RXN}} | |
| − | + | {{#set: produced by=THIOESTER-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name=3 | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:13, 18 March 2018
Contents
Metabolite CPD66-39
- common name:
- a 2,3,4-saturated fatty acid
- Synonym(s):
