Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_612 == * left end position: ** 9844 * transcription direction: ** POSITIVE * right end position: ** 11388 * centisome position: ** 31.73743...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Gene Tiso_gene_612 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 9844
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
** 11388
−
* molecular weight:
+
* centisome position:
−
** 987.845    
+
** 31.737434    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 
−
** (S)-3-hydroxy-14:1-Δ5-CoA
 
−
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14393]]
+
* [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9844}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=11388}}
−
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: centisome position=31.737434   }}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556}}
−
{{#set: molecular weight=987.845   }}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14393}}
+

Revision as of 19:13, 18 March 2018

Gene Tiso_gene_612

  • left end position:
    • 9844
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11388
  • centisome position:
    • 31.737434
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=4-hydroxybenzoate&oldid=22830"