Difference between revisions of "GLYCOLLATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3DJ-11366 CPD3DJ-11366] == * smiles: ** CCCCCCCCCCCCCC=CC(O)C([N+])COP(=O)([O-])[O-] * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3DJ-11366 CPD3DJ-11366] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCC=CC(O)C([N+])COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DUYSYHSSBDVJSM-KRWOKUGFSA-M |
* common name: | * common name: | ||
| − | ** | + | ** sphingosine 1-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 378.468 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3DJ-11230]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3DJ-11417]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06124 C06124] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60119 60119] |
| − | * | + | * METABOLIGHTS : MTBLC60119 |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878582 46878582] |
| − | {{#set: common name= | + | * HMDB : HMDB00277 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CCCCCCCCCCCCCC=CC(O)C([N+])COP(=O)([O-])[O-]}} |
| − | + | {{#set: inchi key=InChIKey=DUYSYHSSBDVJSM-KRWOKUGFSA-M}} | |
| − | {{#set: consumed by= | + | {{#set: common name=sphingosine 1-phosphate}} |
| − | {{#set: produced by= | + | {{#set: molecular weight=378.468 }} |
| + | {{#set: consumed by=RXN3DJ-11230}} | ||
| + | {{#set: produced by=RXN3DJ-11417}} | ||
Revision as of 18:14, 18 March 2018
Contents
Metabolite CPD3DJ-11366
- smiles:
- CCCCCCCCCCCCCC=CC(O)C([N+])COP(=O)([O-])[O-]
- inchi key:
- InChIKey=DUYSYHSSBDVJSM-KRWOKUGFSA-M
- common name:
- sphingosine 1-phosphate
- molecular weight:
- 378.468
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCC=CC(O)C([N+])COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
