Difference between revisions of "Tiso gene 7506"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5885 PWY-5885] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 
* common name:
 
* common name:
−
** wax esters biosynthesis II
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 429.662   
 
* Synonym(s):
 
* Synonym(s):
−
** WS/DGAT biosynthesis
 
−
** petunia wax biosynthesis
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN66-23]]
−
* [[RXN-7904]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.75-RXN 2.3.1.75-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13273 RXN-13273]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13293 RXN-13293]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33090}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
−
{{#set: taxonomic range=TAX-4751}}
+
* CHEBI:
−
{{#set: common name=wax esters biosynthesis II}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
−
{{#set: common name=WS/DGAT biosynthesis|petunia wax biosynthesis}}
+
* HMDB : HMDB12166
−
{{#set: reaction found=1}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: reaction not found=4}}
+
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
−
{{#set: completion rate=25.0}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
 +
{{#set: molecular weight=429.662    }}
 +
{{#set: consumed by=RXN66-23}}

Revision as of 18:18, 18 March 2018

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 429.662
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7506&oldid=23277"