Difference between revisions of "METHIONYL-TRNA-FORMYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** dTDP-L-rhamnose biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[DTDPDEHYRHAMREDUCT-RXN]] | |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_4472]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[DTDPGLUCDEHYDRAT-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_12394]] | ||
+ | *** [[Tiso_gene_7329]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[DTDPGLUCOSEPP-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_14704]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DTDPDEHYDRHAMEPIM-RXN DTDPDEHYDRHAMEPIM-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=DTDPRHAMSYN-PWY DTDPRHAMSYN-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2157}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=dTDP-L-rhamnose biosynthesis I}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=75.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:18, 18 March 2018
Pathway DTDPRHAMSYN-PWY
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- DTDPDEHYRHAMREDUCT-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPGLUCOSEPP-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: