Difference between revisions of "ATCDm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RLBIQVVOMOPOHC-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** methyl parathion |
| + | * molecular weight: | ||
| + | ** 263.204 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dimethyl-parathion |
| − | ** | + | ** parathion-methyl |
| + | ** methyl paration | ||
| + | ** methylthiophos | ||
| + | ** cekumethion | ||
| + | ** oleovofotox | ||
| + | ** thiophenit | ||
| + | ** devithion | ||
| + | ** metacide | ||
| + | ** metaphos | ||
| + | ** quinophos | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-8743]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4130 4130] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3987.html 3987] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38746 38746] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14228 C14228] |
| + | {{#set: smiles=COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S}} | ||
| + | {{#set: inchi key=InChIKey=RLBIQVVOMOPOHC-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=methyl parathion}} | ||
| + | {{#set: molecular weight=263.204 }} | ||
| + | {{#set: common name=dimethyl-parathion|parathion-methyl|methyl paration|methylthiophos|cekumethion|oleovofotox|thiophenit|devithion|metacide|metaphos|quinophos}} | ||
| + | {{#set: consumed by=RXN-8743}} | ||
Revision as of 19:18, 18 March 2018
Contents
Metabolite CPD-8973
- smiles:
- COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S
- inchi key:
- InChIKey=RLBIQVVOMOPOHC-UHFFFAOYSA-N
- common name:
- methyl parathion
- molecular weight:
- 263.204
- Synonym(s):
- dimethyl-parathion
- parathion-methyl
- methyl paration
- methylthiophos
- cekumethion
- oleovofotox
- thiophenit
- devithion
- metacide
- metaphos
- quinophos
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S" cannot be used as a page name in this wiki.
