Difference between revisions of "CPD-667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-form-FeS-Cluster-Scaffold-Proteins D-form-FeS-Cluster-Scaffold-Proteins] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] == * smiles: ** CC(C)=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C | ||
+ | * inchi key: | ||
+ | ** InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 4,4-dimethyl-cholesta-8,12,24-trienol |
+ | * molecular weight: | ||
+ | ** 410.682 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | ||
+ | ** 4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol | ||
+ | ** 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-306]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN3O-130]] |
+ | * [[RXN66-305]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443212 443212] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17813 17813] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11455 C11455] | ||
+ | * HMDB : HMDB01023 | ||
+ | {{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}} | ||
+ | {{#set: inchi key=InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N}} | ||
+ | {{#set: common name=4,4-dimethyl-cholesta-8,12,24-trienol}} | ||
+ | {{#set: molecular weight=410.682 }} | ||
+ | {{#set: common name=17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol|4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol|4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol}} | ||
+ | {{#set: consumed by=RXN66-306}} | ||
+ | {{#set: produced by=RXN3O-130|RXN66-305}} |
Revision as of 18:19, 18 March 2018
Contents
Metabolite 44-DIMETHYL-CHOLESTA-812-24-TRIENOL
- smiles:
- CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
- inchi key:
- InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N
- common name:
- 4,4-dimethyl-cholesta-8,12,24-trienol
- molecular weight:
- 410.682
- Synonym(s):
- 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
- 4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol
- 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.
"17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol" cannot be used as a page name in this wiki.