Difference between revisions of "RXN1G-184"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMIDOTRANS-RXN GLUTAMIDOTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMIDOTRANS-RXN GLUTAMIDOTRANS-RXN] ==
* smiles:
+
* direction:
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K
+
** [http://enzyme.expasy.org/EC/4.3.2.M2 EC-4.3.2.M2]
* common name:
+
** 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
+
* molecular weight:
+
** 494.375   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** imidazole glycerol phosphate synthase cyclase subunit
 +
** Imidazole glycerol phosphate synthase cyclase subunit (EC 4.1.3.-)
 +
** Imidazole glycerol phosphate synthase amidotransferase subunit (EC 2.4.2.-)
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-16483]]
+
** 1 [[GLN]][c] '''+''' 1 [[PHOSPHORIBULOSYL-FORMIMINO-AICAR-P]][c] '''=>''' 1 [[D-ERYTHRO-IMIDAZOLE-GLYCEROL-P]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AICAR]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-glutamine[c] '''+''' 1 phosphoribulosylformimino-AICAR-phosphate[c] '''=>''' 1 D-erythro-imidazole-glycerol-phosphate[c] '''+''' 1 L-glutamate[c] '''+''' 1 H+[c] '''+''' 1 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1565]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_11199]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
* [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820540 91820540]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24793 24793]
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04558 R04558]
{{#set: common name=4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: molecular weight=494.375    }}
+
{{#set: ec number=EC-4.3.2.M2}}
{{#set: produced by=RXN-16483}}
+
{{#set: common name=imidazole glycerol phosphate synthase cyclase subunit|Imidazole glycerol phosphate synthase cyclase subunit (EC 4.1.3.-)|Imidazole glycerol phosphate synthase amidotransferase subunit (EC 2.4.2.-)}}
 +
{{#set: gene associated=Tiso_gene_1565|Tiso_gene_11199}}
 +
{{#set: in pathway=HISTSYN-PWY}}
 +
{{#set: reconstruction category=orthology|manual}}
 +
{{#set: reconstruction source=manual-primary_network|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 19:19, 18 March 2018

Reaction GLUTAMIDOTRANS-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):
    • imidazole glycerol phosphate synthase cyclase subunit
    • Imidazole glycerol phosphate synthase cyclase subunit (EC 4.1.3.-)
    • Imidazole glycerol phosphate synthase amidotransferase subunit (EC 2.4.2.-)

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links