Difference between revisions of "TransportSeed MN+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14424 CPD-14424] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Gene == Gene Tiso_gene_14463 == * left end position: ** 1112 * transcription direction: ** POSITIVE * right end position: ** 1637 * centisome position: ** 19.7128...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14424 CPD-14424] ==
+
== Gene Tiso_gene_14463 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1112
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KIDYDCLNVXONEF-PYBSMVOOSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA
+
** 1637
−
* molecular weight:
+
* centisome position:
−
** 1091.996    
+
** 19.712816    
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosa-5,8,11,14,17-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13444]]
+
* [[KDOTRANS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-13443]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[athaliana]]
 +
* [[KDOTRANS2-RXN]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 +
* [[KDOSYN-PWY]]
 +
* [[PWY-7675]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1112}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551548 72551548]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1637}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76460 76460]
+
{{#set: centisome position=19.712816   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=KDOTRANS-RXN|KDOTRANS2-RXN}}
−
{{#set: inchi key=InChIKey=KIDYDCLNVXONEF-PYBSMVOOSA-J}}
+
{{#set: pathway associated=KDOSYN-PWY|PWY-7675}}
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA}}
+
−
{{#set: molecular weight=1091.996   }}
+
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosa-5,8,11,14,17-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13444}}
+
−
{{#set: produced by=RXN-13443}}
+

Revision as of 18:20, 18 March 2018

Gene Tiso_gene_14463

  • left end position:
    • 1112
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1637
  • centisome position:
    • 19.712816
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TransportSeed_MN%2B2&oldid=23628"