Difference between revisions of "Chlorophyllides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...")
(Created page with "Category:Gene == Gene Tiso_gene_826 == * left end position: ** 17817 * transcription direction: ** NEGATIVE * right end position: ** 20809 * centisome position: ** 62.3779...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
+
== Gene Tiso_gene_826 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)=C(O)C(=O)O1)
+
** 17817
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** dehydro-D-arabinono-1,4-lactone
+
** 20809
−
* molecular weight:
+
* centisome position:
−
** 146.099    
+
** 62.3779    
 
* Synonym(s):
 
* Synonym(s):
−
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 
−
** D-erythro-ascorbic acid
 
−
** D-erythro-ascorbate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN0-5462]]
−
* [[1.1.3.37-RXN]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=17817}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=20809}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
+
{{#set: centisome position=62.3779   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
+
−
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
+
−
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
+
−
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
+
−
{{#set: molecular weight=146.099   }}
+
−
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
+
−
{{#set: produced by=1.1.3.37-RXN}}
+

Revision as of 18:20, 18 March 2018

Gene Tiso_gene_826

  • left end position:
    • 17817
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 20809
  • centisome position:
    • 62.3779
  • Synonym(s):

Reactions associated

  • RXN0-5462
    • in-silico_annotation
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Chlorophyllides&oldid=23653"