Difference between revisions of "PWY0-1295"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] == * smiles: ** C(C(C(C(C(O)CO)O)O)O)O * inchi key: ** InChIKey=FBPFZTCFMRRESA...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] ==
* smiles:
+
* taxonomic range:
** C(C(C(C(C(O)CO)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3042 TAX-3042]
** InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
** L-iditol
+
** astaxanthin biosynthesis (bacteria, fungi, algae)
* molecular weight:
+
** 182.173   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-8025]]
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_10837]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-8026]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10837]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8184 RXN-8184]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8185 RXN-8185]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8186 RXN-8186]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8187 RXN-8187]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8189 RXN-8189]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8190 RXN-8190]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8214 RXN-8214]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8215 RXN-8215]
 
== External links  ==
 
== External links  ==
* CAS : 488-45-9
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3042}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460044 5460044]
+
{{#set: taxonomic range=TAX-4751}}
* HMDB : HMDB11632
+
{{#set: common name=astaxanthin biosynthesis (bacteria, fungi, algae)}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C01507 C01507]
+
{{#set: total reaction=10}}
* CHEMSPIDER:
+
{{#set: completion rate=20.0}}
** [http://www.chemspider.com/Chemical-Structure.4573729.html 4573729]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18202 18202]
+
* METABOLIGHTS : MTBLC18202
+
{{#set: smiles=C(C(C(C(C(O)CO)O)O)O)O}}
+
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N}}
+
{{#set: common name=L-iditol}}
+
{{#set: molecular weight=182.173    }}
+
{{#set: consumed or produced by=L-IDITOL-2-DEHYDROGENASE-RXN}}
+

Revision as of 18:21, 18 March 2018

Pathway PWY-5288

  • taxonomic range:
  • common name:
    • astaxanthin biosynthesis (bacteria, fungi, algae)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links