Difference between revisions of "RXN-16425"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_4659 == * left end position: ** 10639 * transcription direction: ** POSITIVE * right end position: ** 11632 * centisome position: ** 72.844...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4659 == |
− | * | + | * left end position: |
− | ** | + | ** 10639 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11632 |
− | * | + | * centisome position: |
− | ** | + | ** 72.84492 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-6386]] |
+ | * [[PWY-6387]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10639}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11632}} | |
− | + | {{#set: centisome position=72.84492 }} | |
− | + | {{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-6386|PWY-6387}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 19:21, 18 March 2018
Gene Tiso_gene_4659
- left end position:
- 10639
- transcription direction:
- POSITIVE
- right end position:
- 11632
- centisome position:
- 72.84492
- Synonym(s):
Reactions associated
- UDPNACETYLMURAMATEDEHYDROG-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation