Difference between revisions of "PWY-7661"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6599 == * left end position: ** 12080 * transcription direction: ** NEGATIVE * right end position: ** 16553 * centisome position: ** 72.184...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * inchi key: ** InC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| − | * | + | * common name: |
| − | ** | + | ** carnosine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 226.235 |
* Synonym(s): | * Synonym(s): | ||
| + | ** ignotine | ||
| + | ** N-β-alanyl-L-histidine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[CARNOSINE-SYNTHASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00386 C00386] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57485 57485] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC15727 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992100 6992100] | ||
| + | * HMDB : HMDB00033 | ||
| + | {{#set: smiles=C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]}} | ||
| + | {{#set: inchi key=InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N}} | ||
| + | {{#set: common name=carnosine}} | ||
| + | {{#set: molecular weight=226.235 }} | ||
| + | {{#set: common name=ignotine|N-β-alanyl-L-histidine}} | ||
| + | {{#set: produced by=CARNOSINE-SYNTHASE-RXN}} | ||
Revision as of 18:22, 18 March 2018
Contents
Metabolite CARNOSINE
- smiles:
- C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+]
- inchi key:
- InChIKey=CQOVPNPJLQNMDC-ZETCQYMHSA-N
- common name:
- carnosine
- molecular weight:
- 226.235
- Synonym(s):
- ignotine
- N-β-alanyl-L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+" cannot be used as a page name in this wiki.
