Difference between revisions of "PWY-6733"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5768 PWY-5768] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5768 PWY-5768] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** pyruvate fermentation to acetate VIII
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ7-CoA
 
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17781]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN0-3962]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6161 RXN-6161]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: common name=pyruvate fermentation to acetate VIII}}
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: reaction found=1}}
{{#set: molecular weight=1015.898    }}
+
{{#set: total reaction=2}}
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: completion rate=50.0}}
{{#set: consumed by=RXN-17781}}
+

Revision as of 18:23, 18 March 2018

Pathway PWY-5768

  • taxonomic range:
  • common name:
    • pyruvate fermentation to acetate VIII
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links