Difference between revisions of "RXN-8443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == * smiles: ** C1(C(O)C(CO)OC1OP(=O)([O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C(O)C(CO)OC1OP(=O)([O-])[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
* inchi key:
+
−
** InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L
+
 
* common name:
 
* common name:
−
** 2-deoxy-α-D-ribose 1-phosphate
+
** L-glutamine biosynthesis III
−
* molecular weight:
+
−
** 212.096   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-D-ribose 1-phosphate
+
** L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)
−
** 2-deoxy-D-ribose-1-phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[ACONITATEDEHYDR-RXN]]
−
* [[THYM-PHOSPH-RXN]]
+
** 1 associated gene(s):
−
* [[URA-PHOSPH-RXN]]
+
*** [[Tiso_gene_13007]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[CITSYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18030]]
 +
*** [[Tiso_gene_9601]]
 +
*** [[Tiso_gene_9603]]
 +
*** [[Tiso_gene_9602]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_1773]]
 +
*** [[Tiso_gene_2581]]
 +
*** [[Tiso_gene_1154]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_13820]]
 +
*** [[Tiso_gene_6647]]
 +
*** [[Tiso_gene_13754]]
 +
*** [[Tiso_gene_14842]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[ISOCITDEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18262]]
 +
*** [[Tiso_gene_10809]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ISOCITRATE-DEHYDROGENASE-NAD+-RXN ISOCITRATE-DEHYDROGENASE-NAD+-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23419734 23419734]
+
{{#set: common name=L-glutamine biosynthesis III}}
−
* CHEMSPIDER:
+
{{#set: common name=L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)}}
−
** [http://www.chemspider.com/Chemical-Structure.10461471.html 10461471]
+
{{#set: reaction found=6}}
−
* CHEBI:
+
{{#set: total reaction=9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57259 57259]
+
{{#set: completion rate=67.0}}
−
* BIGG : 2dr1p
+
−
* HMDB : HMDB01351
+
−
{{#set: smiles=C1(C(O)C(CO)OC1OP(=O)([O-])[O-])}}
+
−
{{#set: inchi key=InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L}}
+
−
{{#set: common name=2-deoxy-α-D-ribose 1-phosphate}}
+
−
{{#set: molecular weight=212.096    }}
+
−
{{#set: common name=deoxy-D-ribose 1-phosphate|2-deoxy-D-ribose-1-phosphate}}
+
−
{{#set: consumed or produced by=THYM-PHOSPH-RXN|URA-PHOSPH-RXN}}
+

Revision as of 19:24, 18 March 2018

Pathway PWY-6549

  • taxonomic range:
  • common name:
    • L-glutamine biosynthesis III
  • Synonym(s):
    • L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8443&oldid=24050"