Difference between revisions of "RXN-12610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE-GLU-N DIHYDROFOLATE-GLU-N] == * common name: ** a 7,8-dihydrofolate * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == * smiles: ** CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == |
| + | * smiles: | ||
| + | ** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate |
| + | * molecular weight: | ||
| + | ** 276.076 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ME-2,4cPP |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-882]] |
| + | * [[RXN-15878]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-302]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[HDS]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869] |
| − | {{#set: consumed by= | + | * CHEMSPIDER: |
| − | {{#set: produced by= | + | ** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483] | ||
| + | * BIGG : 2mecdp | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453] | ||
| + | {{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}} | ||
| + | {{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}} | ||
| + | {{#set: molecular weight=276.076 }} | ||
| + | {{#set: common name=ME-2,4cPP}} | ||
| + | {{#set: consumed by=RXN0-882|RXN-15878}} | ||
| + | {{#set: produced by=RXN0-302}} | ||
| + | {{#set: reversible reaction associated=HDS}} | ||
Revision as of 18:24, 18 March 2018
Contents
Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE
- smiles:
- CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
- inchi key:
- InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
- common name:
- 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
- molecular weight:
- 276.076
- Synonym(s):
- ME-2,4cPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)" cannot be used as a page name in this wiki.
