Difference between revisions of "Tiso gene 13794"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOINASE-RXN ALLANTOINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOINASE-RXN ALLANTOINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.5.2.5 EC-3.5.2.5] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[WATER]][c] '''+''' 1 [[S-ALLANTOIN]][c] '''=>''' 1 [[ALLANTOATE]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 (S)-(+)-allantoin[c] '''=>''' 1 allantoate[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-5697]], allantoin degradation to ureidoglycolate I (urea producing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5697 PWY-5697] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-5698]], allantoin degradation to ureidoglycolate II (ammonia producing): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5698 PWY-5698] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02425 R02425] | |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/P77671 P77671] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P32375 P32375] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: ec number=EC-3.5.2.5}} |
− | ** [http://www. | + | {{#set: in pathway=PWY-5697|PWY-5698}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | ** [http://www. | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:24, 18 March 2018
Contents
Reaction ALLANTOINASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 S-ALLANTOIN[c] => 1 ALLANTOATE[c] + 1 PROTON[c]
- With common name(s):
- 1 H2O[c] + 1 (S)-(+)-allantoin[c] => 1 allantoate[c] + 1 H+[c]
Genes associated with this reaction
Pathways
- PWY-5697, allantoin degradation to ureidoglycolate I (urea producing): PWY-5697
- 2 reactions found over 2 reactions in the full pathway
- PWY-5698, allantoin degradation to ureidoglycolate II (ammonia producing): PWY-5698
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links