Difference between revisions of "CPD-13907"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16559 RXN-16559] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16559 RXN-16559] ==
* smiles:
+
* direction:
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
** [http://enzyme.expasy.org/EC/1.1.1.211 EC-1.1.1.211]
* common name:
+
** methylacrylyl-CoA
+
* molecular weight:
+
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
** methacrylyl-CoA
 
** 2-methylprop-2-enoyl-CoA
 
** methacrylyl-coenzyme A
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[MEPROPCOA-FAD-RXN]]
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-17814]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[CPD-17815]][c] '''+''' 1 [[PROTON]][c]
* [[MCDH]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA[c] '''=>''' 1 NADH[c] '''+''' 1 (11Z)-3-oxo-hexadecenoyl-CoA[c] '''+''' 1 H+[c]
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14262]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
 +
** '''6''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 6008-91-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.211}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: gene associated=Tiso_gene_14262}}
* CHEBI:
+
{{#set: in pathway=PWY-7656}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
{{#set: reconstruction tool=pathwaytools}}
* HMDB : HMDB01011
+
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
{{#set: common name=methylacrylyl-CoA}}
+
{{#set: molecular weight=831.577    }}
+
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
{{#set: produced by=MEPROPCOA-FAD-RXN|MCDH}}
+
{{#set: consumed or produced by=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Revision as of 19:26, 18 March 2018

Reaction RXN-16559

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA[c] => 1 NADH[c] + 1 (11Z)-3-oxo-hexadecenoyl-CoA[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
    • 6 reactions found over 22 reactions in the full pathway

Reconstruction information

External links