Difference between revisions of "RXN-14973"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] == * smiles: ** C1(C(C(C(C(C1O)O)O)O)O)O * inchi key: ** InChIKey=CD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-275...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281] ==
* smiles:
+
* taxonomic range:
** C1(C(C(C(C(C1O)O)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N
+
 
* common name:
 
* common name:
** myo-inositol
+
** sphingomyelin metabolism
* molecular weight:
+
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-1,2,3,5-trans-4,6-Cyclohexanehexol
 
** dambose
 
** mesoinositol
 
** meso-inositol
 
** M-inositol
 
** 1,2,3,5/4,6 inositol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[2.7.8.11-RXN]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
* [[2.4.1.123-RXN]]
+
* [[RXN-12339]]
== Reaction(s) known to produce the compound ==
+
** 0 associated gene:
* [[RXN-10954]]
+
** 1 reconstruction source(s) associated:
* [[RXN-10953]]
+
*** [[annotation-in-silico_annotation]]
* [[RXN-7253]]
+
* [[RXN-15211]]
* [[RXN-10952]]
+
** 0 associated gene:
* [[RXN-8281]]
+
** 1 reconstruction source(s) associated:
* [[RXN-10949]]
+
*** [[annotation-in-silico_annotation]]
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN-15212]]
* [[RXN0-5408]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_12644]]
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
** 1 reconstruction source(s) associated:
* [[2.4.1.67-RXN]]
+
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 6917-35-7
+
{{#set: taxonomic range=TAX-2759}}
* CAS : 87-89-8
+
{{#set: taxonomic range=TAX-2}}
* METABOLIGHTS : MTBLC17268
+
{{#set: common name=sphingomyelin metabolism}}
* DRUGBANK : DB03106
+
{{#set: reaction found=3}}
* PUBCHEM:
+
{{#set: total reaction=3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=892 892]
+
{{#set: completion rate=100.0}}
* KNAPSACK : C00001164
+
* HMDB : HMDB00211
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00137 C00137]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.868.html 868]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17268 17268]
+
* BIGG : inost
+
{{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}}
+
{{#set: inchi key=InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N}}
+
{{#set: common name=myo-inositol}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: common name=cis-1,2,3,5-trans-4,6-Cyclohexanehexol|dambose|mesoinositol|meso-inositol|M-inositol|1,2,3,5/4,6 inositol}}
+
{{#set: consumed by=2.7.8.11-RXN|2.4.1.123-RXN}}
+
{{#set: produced by=RXN-10954|RXN-10953|RXN-7253|RXN-10952|RXN-8281|RXN-10949|MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN0-5408}}
+
{{#set: consumed or produced by=MYO-INOSITOL-2-DEHYDROGENASE-RXN|2.4.1.67-RXN}}
+

Revision as of 19:27, 18 March 2018

Pathway PWY3DJ-11281

  • taxonomic range:
  • common name:
    • sphingomyelin metabolism
  • Synonym(s):

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links