Difference between revisions of "Tiso gene 16450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=GRUGZHAOXOPASC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] == * common name: ** a malonyl-[acp] * Synonym(s): ** malonyl-[acyl-ca...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] ==
* smiles:
+
** CSCCCCC(=O)C([O-])=O
+
* inchi key:
+
** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 6-(methylthio)-2-oxohexanoate
+
** a malonyl-[acp]
* molecular weight:
+
** 175.222   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-(methylthio)-2-oxohexanoic acid
+
** malonyl-[acyl-carrier protein]
 +
** malonyl-S-ACP
 +
** malonyl-acyl-carrier-protein
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11474]]
 +
* [[RXN-16615]]
 +
* [[RXN1G-324]]
 +
* [[RXN1G-306]]
 +
* [[RXN-11479]]
 +
* [[RXN1G-138]]
 +
* [[RXN1G-132]]
 +
* [[RXN-8391]]
 +
* [[RXN-14972]]
 +
* [[RXN3O-1803]]
 +
* [[2.3.1.180-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[2.3.1.179-RXN]]
 +
* [[RXN-9523]]
 +
* [[RXN-9527]]
 +
* [[RXN-10658]]
 +
* [[RXN1G-1003]]
 +
* [[RXN-16629]]
 +
* [[RXN1G-236]]
 +
* [[RXN-10654]]
 +
* [[RXN-16621]]
 +
* [[RXN1G-218]]
 +
* [[RXN-16625]]
 +
* [[RXN0-2141]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN1G-26]]
 +
* [[RXN1G-840]]
 +
* [[RXN-9539]]
 +
* [[RXN-9535]]
 +
* [[RXN-9516]]
 +
* [[RXN-9531]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18209]]
+
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
* [[RXNQT-4165]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.3.1.41-RXN]]
 +
* [[RXN1G-460]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a malonyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
+
{{#set: common name=malonyl-[acyl-carrier protein]|malonyl-S-ACP|malonyl-acyl-carrier-protein}}
* KNAPSACK : C00007648
+
{{#set: consumed by=RXN-11474|RXN-16615|RXN1G-324|RXN1G-306|RXN-11479|RXN1G-138|RXN1G-132|RXN-8391|RXN-14972|RXN3O-1803|2.3.1.180-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|2.3.1.179-RXN|RXN-9523|RXN-9527|RXN-10658|RXN1G-1003|RXN-16629|RXN1G-236|RXN-10654|RXN-16621|RXN1G-218|RXN-16625|RXN0-2141|3-OXOACYL-ACP-SYNTH-RXN|RXN1G-26|RXN1G-840|RXN-9539|RXN-9535|RXN-9516|RXN-9531}}
{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
+
{{#set: produced by=MALONYL-COA-ACP-TRANSACYL-RXN}}
{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
+
{{#set: reversible reaction associated=2.3.1.41-RXN|RXN1G-460}}
{{#set: common name=6-(methylthio)-2-oxohexanoate}}
+
{{#set: molecular weight=175.222    }}
+
{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
+
{{#set: produced by=RXN-18209|RXNQT-4165}}
+

Revision as of 18:27, 18 March 2018

Metabolite MALONYL-ACP

  • common name:
    • a malonyl-[acp]
  • Synonym(s):
    • malonyl-[acyl-carrier protein]
    • malonyl-S-ACP
    • malonyl-acyl-carrier-protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a malonyl-[acp" cannot be used as a page name in this wiki.
"malonyl-[acyl-carrier protein" cannot be used as a page name in this wiki.