Difference between revisions of "CPD-101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] == * smiles: ** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-93 RXN1F-93] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11756 CPD-11756] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-93 RXN1F-93] ==
* smiles:
+
* direction:
** C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N
+
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
* common name:
+
** 4'-O-demethylrebeccamycin
+
* molecular weight:
+
** 556.358   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10847]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[DIHYDROKAEMPFEROL-CMPD]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-90]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (+)-dihydrokaempferol[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 kaempferol[c] '''+''' 1 H2O[c] '''+''' 1 CO2[c] '''+''' 1 succinate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3330]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787]
 +
** '''5''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* LIGAND-RXN:
** [http://www.genome.jp/dbget-bin/www_bget?C19700 C19700]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03126 R03126]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=595389 595389]
+
{{#set: ec number=EC-1.14.11.23}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_3330}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45259192 45259192]
+
{{#set: in pathway=PWY-3101|PWY-6787}}
{{#set: smiles=C1(C=C(C5(=C(C=1)C4(C2(C(NC(C=2C6(C3(C=CC=C(C=3N(C(C=4N5)=6)C7(C(C(C(C(CO)O7)O)O)O))Cl)))=O)=O))))Cl)}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=NNPBOGAWNUIKAO-RJZBGXQMSA-N}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
{{#set: common name=4'-O-demethylrebeccamycin}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=556.358    }}
+
{{#set: consumed by=RXN-10847}}
+

Revision as of 19:28, 18 March 2018

Reaction RXN1F-93

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3101, flavonol biosynthesis: PWY-3101
    • 4 reactions found over 7 reactions in the full pathway
  • PWY-6787, flavonoid biosynthesis (in equisetum): PWY-6787
    • 5 reactions found over 10 reactions in the full pathway

Reconstruction information

External links