Difference between revisions of "Tiso gene 17657"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] == * smiles: ** C(O)C(C(O)C(O)C(C([O-])=O)O)O * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14904 RXN-14904] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14904 RXN-14904] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPD-10330]][c] '''<=>''' 1 [[CPD0-1108]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 α-D-ribofuranose[c] '''<=>''' 1 β-D-ribofuranose[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[RIBOKIN-PWY]], ribose degradation: [http://metacyc.org/META/NEW-IMAGE?object=RIBOKIN-PWY RIBOKIN-PWY] | ||
| + | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=RIBOKIN-PWY}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 18:28, 18 March 2018
Contents
Reaction RXN-14904
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 α-D-ribofuranose[c] <=> 1 β-D-ribofuranose[c]
Genes associated with this reaction
Pathways
- RIBOKIN-PWY, ribose degradation: RIBOKIN-PWY
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
