Difference between revisions of "CPD-2961"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1223 RXN-1223] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1223 RXN-1223] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J
+
** [http://enzyme.expasy.org/EC/3.13.1.1 EC-3.13.1.1]
−
* common name:
+
−
** icosatrienoyl-2-enoyl CoA
+
−
* molecular weight:
+
−
** 1049.959   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 18:3Δ9,12,15
 
−
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
 
−
** eicosatrienoyl-2-enoyl CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12997]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[SO3]][c] '''+''' 1 [[CPD-12575]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[UDP-SULFOQUINOVOSE]][c]
−
* [[RXN-13001]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 sulfite[c] '''+''' 1 UDP-α-D-glucose[c] '''+''' 1 H+[c] '''=>''' 1 H2O[c] '''+''' 1 UDP-α-D-sulfoquinovopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2295]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
* [[PWYQT-4427]], sulfoquinovosyl diacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551551 72551551]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13197 13197]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76456 76456]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05775 R05775]
−
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J}}
+
{{#set: ec number=EC-3.13.1.1}}
−
{{#set: common name=icosatrienoyl-2-enoyl CoA}}
+
{{#set: gene associated=Tiso_gene_2295}}
−
{{#set: molecular weight=1049.959    }}
+
{{#set: in pathway=PWYQT-4427}}
−
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA|eicosatrienoyl-2-enoyl CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed by=RXN-12997}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis|orthology-esiliculosus}}
−
{{#set: produced by=RXN-13001}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 19:29, 18 March 2018

Reaction RXN-1223

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sulfite[c] + 1 UDP-α-D-glucose[c] + 1 H+[c] => 1 H2O[c] + 1 UDP-α-D-sulfoquinovopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYQT-4427, sulfoquinovosyl diacylglycerol biosynthesis: PWYQT-4427
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-2961&oldid=24700"