Difference between revisions of "PWY-7124"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
 +
* inchi key:
 +
** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
 
* common name:
 
* common name:
−
** chloroplast_beta-keto_acyl_reductase
+
** 9-cis-violaxanthin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** 600.88   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-c-violaxanthin
 +
** 9cViol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7974]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-14271]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-14275]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 3-oxoicosanoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 (3R)-3-hydroxy-arachidoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9871]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
−
** '''16''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218]
−
{{#set: ec number=EC-1.1.1.330}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_9871}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305]
−
{{#set: in pathway=PWY-7036}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}}
 +
{{#set: common name=9-cis-violaxanthin}}
 +
{{#set: molecular weight=600.88    }}
 +
{{#set: common name=9-c-violaxanthin|9cViol}}
 +
{{#set: consumed by=RXN-7974}}

Revision as of 18:29, 18 March 2018

Metabolite CPD-7196

  • smiles:
    • CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
  • inchi key:
    • InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
  • common name:
    • 9-cis-violaxanthin
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9-c-violaxanthin
    • 9cViol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7124&oldid=24717"