Difference between revisions of "Tiso gene 7049"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == * smiles: ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K |
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-β-neuraminate 9-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 386.229 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-acetyl-β-neuraminate-9-P |
+ | ** N-acetyl-β-neuraminic acid 9-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9988]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06241 C06241] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27438 27438] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC27438 |
− | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658964 90658964] |
− | {{#set: molecular weight= | + | * HMDB : HMDB04381 |
− | {{#set: common name= | + | {{#set: smiles=CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)}} |
− | + | {{#set: inchi key=InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K}} | |
− | {{#set: produced by=RXN- | + | {{#set: common name=N-acetyl-β-neuraminate 9-phosphate}} |
+ | {{#set: molecular weight=386.229 }} | ||
+ | {{#set: common name=N-acetyl-β-neuraminate-9-P|N-acetyl-β-neuraminic acid 9-phosphate}} | ||
+ | {{#set: produced by=RXN-9988}} |
Revision as of 18:29, 18 March 2018
Contents
Metabolite N-ACETYL-NEURAMINATE-9P
- smiles:
- CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)
- inchi key:
- InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K
- common name:
- N-acetyl-β-neuraminate 9-phosphate
- molecular weight:
- 386.229
- Synonym(s):
- N-acetyl-β-neuraminate-9-P
- N-acetyl-β-neuraminic acid 9-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)" cannot be used as a page name in this wiki.