Difference between revisions of "RXN-8770"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1081 RXN0-1081] == * direction: ** LEFT-TO-RIGHT * common name: ** trna-specific_adenosinedeam...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) |
| + | * inchi key: | ||
| + | ** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 7,8-dihydrolumazine |
| − | * | + | * molecular weight: |
| − | + | ** 166.139 | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-15261]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555] | |
| − | {{#set: | + | {{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}} |
| − | + | {{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}} | |
| − | + | {{#set: common name=7,8-dihydrolumazine}} | |
| − | {{#set: | + | {{#set: molecular weight=166.139 }} |
| − | {{#set: | + | {{#set: produced by=RXN-15261}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 19:29, 18 March 2018
Contents
Metabolite CPD-16458
- smiles:
- C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
- inchi key:
- InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
- common name:
- 7,8-dihydrolumazine
- molecular weight:
- 166.139
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
