Difference between revisions of "Tiso gene 3577"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5329 PWY-5329] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5329 PWY-5329] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-cysteine degradation III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_6815]] | ||
| + | *** [[Tiso_gene_17718]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[MERCAPYSTRANS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_5838]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40674}} | |
| − | + | {{#set: common name=L-cysteine degradation III}} | |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:30, 18 March 2018
Pathway PWY-5329
- taxonomic range:
- common name:
- L-cysteine degradation III
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- CYSTEINE-AMINOTRANSFERASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- MERCAPYSTRANS-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
