Difference between revisions of "Tiso gene 8027"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == * smiles: ** C(OP(=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lichenin Lichenin] == * common name: ** lichenan * Synonym(s): ** lichenin ** moss starch == R...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lichenin Lichenin] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)
+
−
* inchi key:
+
−
** InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K
+
 
* common name:
 
* common name:
−
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+
** lichenan
−
* molecular weight:
+
−
** 346.21   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P
+
** lichenin
−
** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate
+
** moss starch
−
** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[IGPSYN-RXN]]
+
* [[3.2.1.73-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[PRAISOM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=lichenan}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266701 45266701]
+
{{#set: common name=lichenin|moss starch}}
−
* CHEBI:
+
{{#set: consumed by=3.2.1.73-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58613 58613]
+
−
* BIGG : 2cpr5p
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01302 C01302]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)}}
+
−
{{#set: inchi key=InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K}}
+
−
{{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+
−
{{#set: molecular weight=346.21    }}
+
−
{{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P}}
+
−
{{#set: consumed by=IGPSYN-RXN}}
+
−
{{#set: produced by=PRAISOM-RXN}}
+

Revision as of 18:30, 18 March 2018

Metabolite Lichenin

  • common name:
    • lichenan
  • Synonym(s):
    • lichenin
    • moss starch

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8027&oldid=24844"