Difference between revisions of "Tiso gene 3374"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17832 RXN-17832] == * direction: ** LEFT-TO-RIGHT * common name: ** trypsin ** trypsin_family *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17832 RXN-17832] ==
* smiles:
+
* direction:
** C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 7,8-dihydrolumazine
+
** trypsin
* molecular weight:
+
** trypsin_family
** 166.139   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.4.21.4 EC-3.4.21.4]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-15261]]
+
** 1 [[CPD-19202]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-19205]][c] '''+''' 1 [[CPD-19203]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine[c] '''+''' 1 H2O[c] '''=>''' 1 L-4-hydroxyphenylglycine-L-arginine[c] '''+''' 1 D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_4147]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_19324]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_13074]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_12875]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7797]], nocardicin A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555]
+
{{#set: common name=trypsin}}
{{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}}
+
{{#set: common name=trypsin_family}}
{{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}}
+
{{#set: ec number=EC-3.4.21.4}}
{{#set: common name=7,8-dihydrolumazine}}
+
{{#set: gene associated=Tiso_gene_4147|Tiso_gene_19324|Tiso_gene_13074|Tiso_gene_12875}}
{{#set: molecular weight=166.139    }}
+
{{#set: in pathway=PWY-7797}}
{{#set: produced by=RXN-15261}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 18:30, 18 March 2018

Reaction RXN-17832

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trypsin
    • trypsin_family
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine[c] + 1 H2O[c] => 1 L-4-hydroxyphenylglycine-L-arginine[c] + 1 D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7797, nocardicin A biosynthesis: PWY-7797
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links