Difference between revisions of "Tiso gene 20050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2777 == * Synonym(s): == Reactions associated == * 3.4.21.4-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_2777 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
 +
* smiles:
 +
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
 +
* inchi key:
 +
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
 +
* common name:
 +
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
 +
* molecular weight:
 +
** 1015.898   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.21.4-RXN]]
+
* [[RXN-16559]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.4.21.4-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
 +
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
 +
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
 +
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
 +
{{#set: molecular weight=1015.898    }}
 +
{{#set: consumed by=RXN-16559}}

Revision as of 19:31, 18 March 2018

Metabolite CPD-17814

  • smiles:
    • CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • inchi key:
    • InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
  • common name:
    • (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
  • molecular weight:
    • 1015.898
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.