Difference between revisions of "Tiso gene 16690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_12871 == * Synonym(s): == Reactions associated == * RXN-14125 ** pantograph-athaliana * THRESYN-RXN ** pantograph-at...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Gene Tiso_gene_12871 ==
* smiles:
+
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
* inchi key:
+
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
* common name:
+
** dihydrogeranylgeranyl diphosphate
+
* molecular weight:
+
** 449.44   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydroGGPP
 
** dihydrogeranylgeranyl-PP
 
** dihydrogeranylgeranyl pyrophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-14125]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[athaliana]]
* [[RXN-7659]]
+
* [[THRESYN-RXN]]
* [[RXN-7658]]
+
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[HOMOSER-THRESYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-14125|THRESYN-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
{{#set: pathway associated=HOMOSER-THRESYN-PWY}}
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: molecular weight=449.44    }}
+
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
{{#set: consumed or produced by=RXN-7659|RXN-7658}}
+

Revision as of 18:31, 18 March 2018

Gene Tiso_gene_12871

  • Synonym(s):

Reactions associated

Pathways associated

External links